C22H27N6O2S+ — CID 143229882
N-[(E)-(4,5-dimethylthiophen-2-yl)methylideneamino]-2-(2-morpholin-4-ylethoxy)-6-pyridin-1-ium-4-ylpyrimidin-4-amine (PubChem CID 143229882) has the molecular formula C22H27N6O2S+ and a molecular weight of 439.57 g/mol. Its IUPAC name is N-[(E)-(4,5-dimethylthiophen-2-yl)methylideneamino]-2-(2-morpholin-4-ylethoxy)-6-pyridin-1-ium-4-ylpyrimidin-4-amine.
| Compound Name | N-[(E)-(4,5-dimethylthiophen-2-yl)methylideneamino]-2-(2-morpholin-4-ylethoxy)-6-pyridin-1-ium-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143229882 |
| Molecular Formula | C22H27N6O2S+ |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(E)-(4,5-dimethylthiophen-2-yl)methylideneamino]-2-(2-morpholin-4-ylethoxy)-6-pyridin-1-ium-4-ylpyrimidin-4-amine |
| SMILES | Cc1cc(/C=N/Nc2cc(-c3cc[nH+]cc3)nc(OCCN3CCOCC3)n2)sc1C |
| InChI | InChI=1S/C22H26N6O2S/c1-16-13-19(31-17(16)2)15-24-27-21-14-20(18-3-5-23-6-4-18)25-22(26-21)30-12-9-28-7-10-29-11-8-28/h3-6,13-15H,7-12H2,1-2H3,(H,25,26,27)/p+1/b24-15+ |
| InChIKey | RDEYSSNWOIAJCN-BUVRLJJBSA-O |
| XLogP | 2.79 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|