C23H31N7O3 — CID 135530125
6-N-[(E)-1H-indol-3-ylmethylideneamino]-4-N-(2-methoxyethyl)-4-N-methyl-2-(2-morpholin-4-ylethoxy)pyrimidine-4,6-diamine (PubChem CID 135530125) has the molecular formula C23H31N7O3 and a molecular weight of 453.55 g/mol. Its IUPAC name is 6-N-[(E)-1H-indol-3-ylmethylideneamino]-4-N-(2-methoxyethyl)-4-N-methyl-2-(2-morpholin-4-ylethoxy)pyrimidine-4,6-diamine.
| Compound Name | 6-N-[(E)-1H-indol-3-ylmethylideneamino]-4-N-(2-methoxyethyl)-4-N-methyl-2-(2-morpholin-4-ylethoxy)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 135530125 |
| Molecular Formula | C23H31N7O3 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 6-N-[(E)-1H-indol-3-ylmethylideneamino]-4-N-(2-methoxyethyl)-4-N-methyl-2-(2-morpholin-4-ylethoxy)pyrimidine-4,6-diamine |
| SMILES | COCCN(C)c1cc(N/N=C/c2c[nH]c3ccccc23)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C23H31N7O3/c1-29(7-11-31-2)22-15-21(26-23(27-22)33-14-10-30-8-12-32-13-9-30)28-25-17-18-16-24-20-6-4-3-5-19(18)20/h3-6,15-17,24H,7-14H2,1-2H3,(H,26,27,28)/b25-17+ |
| InChIKey | LWSIMWXBPGBXPW-KOEQRZSOSA-N |
| XLogP | 2.20 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|