C23H28N6O4 — CID 135546643
2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-N-[(E)-1H-indol-3-ylmethylideneamino]-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 135546643) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-N-[(E)-1H-indol-3-ylmethylideneamino]-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-N-[(E)-1H-indol-3-ylmethylideneamino]-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 135546643 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-N-[(E)-1H-indol-3-ylmethylideneamino]-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CC1(C)OCC(COc2nc(N/N=C/c3c[nH]c4ccccc34)cc(N3CCOCC3)n2)O1 |
| InChI | InChI=1S/C23H28N6O4/c1-23(2)32-15-17(33-23)14-31-22-26-20(11-21(27-22)29-7-9-30-10-8-29)28-25-13-16-12-24-19-6-4-3-5-18(16)19/h3-6,11-13,17,24H,7-10,14-15H2,1-2H3,(H,26,27,28)/b25-13+ |
| InChIKey | FUVBZPIJWSRWCZ-DHRITJCHSA-N |
| XLogP | 2.77 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|