C25H34N6O3 — CID 143847053
2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-6-N-[(E)-1H-indol-3-ylmethylideneamino]-4-N,4-N-dipropylpyrimidine-4,6-diamine (PubChem CID 143847053) has the molecular formula C25H34N6O3 and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-6-N-[(E)-1H-indol-3-ylmethylideneamino]-4-N,4-N-dipropylpyrimidine-4,6-diamine.
| Compound Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-6-N-[(E)-1H-indol-3-ylmethylideneamino]-4-N,4-N-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 143847053 |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-6-N-[(E)-1H-indol-3-ylmethylideneamino]-4-N,4-N-dipropylpyrimidine-4,6-diamine |
| SMILES | CCCN(CCC)c1cc(N/N=C/c2c[nH]c3ccccc23)nc(OCC2COC(C)(C)O2)n1 |
| InChI | InChI=1S/C25H34N6O3/c1-5-11-31(12-6-2)23-13-22(28-24(29-23)32-16-19-17-33-25(3,4)34-19)30-27-15-18-14-26-21-10-8-7-9-20(18)21/h7-10,13-15,19,26H,5-6,11-12,16-17H2,1-4H3,(H,28,29,30)/b27-15+ |
| InChIKey | BPJAYCQDNCGFHW-JFLMPSFJSA-N |
| XLogP | 4.56 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|