C23H26N8O2 — CID 153389201
2-[2-hydroxyethyl-[4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 153389201) has the molecular formula C23H26N8O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 153389201 |
| Molecular Formula | C23H26N8O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-[2-hydroxyethyl-[4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-6-(4-methylanilino)-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | Cc1ccc(Nc2nc(N/N=C/c3c[nH]c4ccccc34)nc(N(CCO)CCO)n2)cc1 |
| InChI | InChI=1S/C23H26N8O2/c1-16-6-8-18(9-7-16)26-21-27-22(29-23(28-21)31(10-12-32)11-13-33)30-25-15-17-14-24-20-5-3-2-4-19(17)20/h2-9,14-15,24,32-33H,10-13H2,1H3,(H2,26,27,28,29,30)/b25-15+ |
| InChIKey | DCKLSDQIRDILKH-MFKUBSTISA-N |
| XLogP | 2.64 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|