C19H18N8 — CID 171147964
2-N-(1H-indol-3-ylmethylideneamino)-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 171147964) has the molecular formula C19H18N8 and a molecular weight of 358.41 g/mol. Its IUPAC name is 2-N-(1H-indol-3-ylmethylideneamino)-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(1H-indol-3-ylmethylideneamino)-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 171147964 |
| Molecular Formula | C19H18N8 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-N-(1H-indol-3-ylmethylideneamino)-6-N-methyl-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NN=Cc2c[nH]c3ccccc23)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C19H18N8/c1-20-17-24-18(23-14-7-3-2-4-8-14)26-19(25-17)27-22-12-13-11-21-16-10-6-5-9-15(13)16/h2-12,21H,1H3,(H3,20,23,24,25,26,27) |
| InChIKey | ZVOWQSZPLNZYSR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|