C24H25N7O — CID 153389202
4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N-(4-methylphenyl)-6-morpholin-4-ylpyrimidine-2,4-diamine (PubChem CID 153389202) has the molecular formula C24H25N7O and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N-(4-methylphenyl)-6-morpholin-4-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N-(4-methylphenyl)-6-morpholin-4-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 153389202 |
| Molecular Formula | C24H25N7O |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N-(4-methylphenyl)-6-morpholin-4-ylpyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(N/N=C/c3c[nH]c4ccccc34)cc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C24H25N7O/c1-17-6-8-19(9-7-17)27-24-28-22(14-23(29-24)31-10-12-32-13-11-31)30-26-16-18-15-25-21-5-3-2-4-20(18)21/h2-9,14-16,25H,10-13H2,1H3,(H2,27,28,29,30)/b26-16+ |
| InChIKey | XHGNASSWAMKZSS-WGOQTCKBSA-N |
| XLogP | 4.29 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|