C12H14N7+ — CID 135514935
3-N-(1H-indol-3-ylmethylideneamino)-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine (PubChem CID 135514935) has the molecular formula C12H14N7+ and a molecular weight of 256.29 g/mol. Its IUPAC name is 3-N-(1H-indol-3-ylmethylideneamino)-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine.
| Compound Name | 3-N-(1H-indol-3-ylmethylideneamino)-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine |
|---|---|
| PubChem CID | 135514935 |
| Molecular Formula | C12H14N7+ |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3-N-(1H-indol-3-ylmethylideneamino)-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine |
| SMILES | Cc1[nH]nc(NN=Cc2c[nH]c3ccccc23)[n+]1N |
| InChI | InChI=1S/C12H13N7/c1-8-16-18-12(19(8)13)17-15-7-9-6-14-11-5-3-2-4-10(9)11/h2-7H,13H2,1H3,(H2,14,15,17,18)/p+1 |
| InChIKey | JYDVUSVDHAPCLV-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|