C13H10ClN5O — CID 135606125
5-chloro-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-pyridazin-6-one (PubChem CID 135606125) has the molecular formula C13H10ClN5O and a molecular weight of 287.71 g/mol. Its IUPAC name is 5-chloro-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 135606125 |
| Molecular Formula | C13H10ClN5O |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-chloro-4-[(2E)-2-(1H-indol-3-ylmethylidene)hydrazinyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N/N=C/c2c[nH]c3ccccc23)c1Cl |
| InChI | InChI=1S/C13H10ClN5O/c14-12-11(7-17-19-13(12)20)18-16-6-8-5-15-10-4-2-1-3-9(8)10/h1-7,15H,(H2,18,19,20)/b16-6+ |
| InChIKey | KZKXVWUREGNZCL-OMCISZLKSA-N |
| XLogP | 2.35 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|