C11H7Cl3N4O — CID 7745615
5-chloro-4-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 7745615) has the molecular formula C11H7Cl3N4O and a molecular weight of 317.56 g/mol. Its IUPAC name is 5-chloro-4-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 7745615 |
| Molecular Formula | C11H7Cl3N4O |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 5-chloro-4-[(2Z)-2-[(2,6-dichlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N/N=C\c2c(Cl)cccc2Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl3N4O/c12-7-2-1-3-8(13)6(7)4-15-17-9-5-16-18-11(19)10(9)14/h1-5H,(H2,17,18,19)/b15-4- |
| InChIKey | WGSUMVYUQBCECH-TVPGTPATSA-N |
| XLogP | 3.18 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|