C11H8BrClN4O — CID 71967341
5-bromo-4-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one (PubChem CID 71967341) has the molecular formula C11H8BrClN4O and a molecular weight of 327.57 g/mol. Its IUPAC name is 5-bromo-4-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one.
| Compound Name | 5-bromo-4-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 71967341 |
| Molecular Formula | C11H8BrClN4O |
| Molecular Weight | 327.57 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | 5-bromo-4-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(NN=Cc2ccccc2Cl)c1Br |
| InChI | InChI=1S/C11H8BrClN4O/c12-10-9(6-15-17-11(10)18)16-14-5-7-3-1-2-4-8(7)13/h1-6H,(H2,16,17,18) |
| InChIKey | PCLAGWMDJSABMS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|