C22H28N8O2 — CID 136642529
6-(4,5-dihydro-1,3-oxazol-2-ylmethoxy)-4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N,2-N-dipropyl-1,3,5-triazine-2,4-diamine (PubChem CID 136642529) has the molecular formula C22H28N8O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 6-(4,5-dihydro-1,3-oxazol-2-ylmethoxy)-4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N,2-N-dipropyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4,5-dihydro-1,3-oxazol-2-ylmethoxy)-4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N,2-N-dipropyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 136642529 |
| Molecular Formula | C22H28N8O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 6-(4,5-dihydro-1,3-oxazol-2-ylmethoxy)-4-N-[(E)-1H-indol-3-ylmethylideneamino]-2-N,2-N-dipropyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCN(CCC)c1nc(N/N=C/c2c[nH]c3ccccc23)nc(OCC2=NCCO2)n1 |
| InChI | InChI=1S/C22H28N8O2/c1-3-10-30(11-4-2)21-26-20(27-22(28-21)32-15-19-23-9-12-31-19)29-25-14-16-13-24-18-8-6-5-7-17(16)18/h5-8,13-14,24H,3-4,9-12,15H2,1-2H3,(H,26,27,28,29)/b25-14+ |
| InChIKey | OXCJZNDZJGUFAD-AFUMVMLFSA-N |
| XLogP | 3.23 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|