C21H30N8O — CID 89358286
N-[(E)-[4-(dipropylamino)-6-[2-(methylamino)ethoxy]-1,3,5-triazin-2-yl]methylideneamino]-1H-indol-3-amine (PubChem CID 89358286) has the molecular formula C21H30N8O and a molecular weight of 410.53 g/mol. Its IUPAC name is N-[(E)-[4-(dipropylamino)-6-[2-(methylamino)ethoxy]-1,3,5-triazin-2-yl]methylideneamino]-1H-indol-3-amine.
| Compound Name | N-[(E)-[4-(dipropylamino)-6-[2-(methylamino)ethoxy]-1,3,5-triazin-2-yl]methylideneamino]-1H-indol-3-amine |
|---|---|
| PubChem CID | 89358286 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | N-[(E)-[4-(dipropylamino)-6-[2-(methylamino)ethoxy]-1,3,5-triazin-2-yl]methylideneamino]-1H-indol-3-amine |
| SMILES | CCCN(CCC)c1nc(/C=N/Nc2c[nH]c3ccccc23)nc(OCCNC)n1 |
| InChI | InChI=1S/C21H30N8O/c1-4-11-29(12-5-2)20-25-19(26-21(27-20)30-13-10-22-3)15-24-28-18-14-23-17-9-7-6-8-16(17)18/h6-9,14-15,22-23,28H,4-5,10-13H2,1-3H3/b24-15+ |
| InChIKey | QVHSGCONWVKZED-BUVRLJJBSA-N |
| XLogP | 3.02 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|