C22H32N6O4 — CID 152755510
2-[C-[6-[2-methoxyethyl(methyl)amino]-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]carbonohydrazonoyl]-4-methylphenol (PubChem CID 152755510) has the molecular formula C22H32N6O4 and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-[C-[6-[2-methoxyethyl(methyl)amino]-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]carbonohydrazonoyl]-4-methylphenol.
| Compound Name | 2-[C-[6-[2-methoxyethyl(methyl)amino]-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]carbonohydrazonoyl]-4-methylphenol |
|---|---|
| PubChem CID | 152755510 |
| Molecular Formula | C22H32N6O4 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-[C-[6-[2-methoxyethyl(methyl)amino]-2-(2-morpholin-4-ylethoxy)pyrimidin-4-yl]carbonohydrazonoyl]-4-methylphenol |
| SMILES | COCCN(C)c1cc(C(=NN)c2cc(C)ccc2O)nc(OCCN2CCOCC2)n1 |
| InChI | InChI=1S/C22H32N6O4/c1-16-4-5-19(29)17(14-16)21(26-23)18-15-20(27(2)6-10-30-3)25-22(24-18)32-13-9-28-7-11-31-12-8-28/h4-5,14-15,29H,6-13,23H2,1-3H3 |
| InChIKey | KTDOWHGWIFKKKX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|