C15H26N4O2 — CID 143229880
6-N,6-N-diethyl-4-(2-morpholin-4-ylethoxy)pyridine-2,6-diamine (PubChem CID 143229880) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 6-N,6-N-diethyl-4-(2-morpholin-4-ylethoxy)pyridine-2,6-diamine.
| Compound Name | 6-N,6-N-diethyl-4-(2-morpholin-4-ylethoxy)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 143229880 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 6-N,6-N-diethyl-4-(2-morpholin-4-ylethoxy)pyridine-2,6-diamine |
| SMILES | CCN(CC)c1cc(OCCN2CCOCC2)cc(N)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-3-19(4-2)15-12-13(11-14(16)17-15)21-10-7-18-5-8-20-9-6-18/h11-12H,3-10H2,1-2H3,(H2,16,17) |
| InChIKey | JCNHDHLCMIPLSZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |