C31H42N4O2 — CID 143450181
6-[1-(4-amino-3-phenylphenyl)ethyl]-4-(2-morpholin-4-ylethoxy)-N,N-dipropylpyridin-2-amine (PubChem CID 143450181) has the molecular formula C31H42N4O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is 6-[1-(4-amino-3-phenylphenyl)ethyl]-4-(2-morpholin-4-ylethoxy)-N,N-dipropylpyridin-2-amine.
| Compound Name | 6-[1-(4-amino-3-phenylphenyl)ethyl]-4-(2-morpholin-4-ylethoxy)-N,N-dipropylpyridin-2-amine |
|---|---|
| PubChem CID | 143450181 |
| Molecular Formula | C31H42N4O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 6-[1-(4-amino-3-phenylphenyl)ethyl]-4-(2-morpholin-4-ylethoxy)-N,N-dipropylpyridin-2-amine |
| SMILES | CCCN(CCC)c1cc(OCCN2CCOCC2)cc(C(C)c2ccc(N)c(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C31H42N4O2/c1-4-13-35(14-5-2)31-23-27(37-20-17-34-15-18-36-19-16-34)22-30(33-31)24(3)26-11-12-29(32)28(21-26)25-9-7-6-8-10-25/h6-12,21-24H,4-5,13-20,32H2,1-3H3 |
| InChIKey | ARFOKOSPYSFEOU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|