C31H41FN8O3 — CID 70081885
1-carbamimidoyl-3-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1,2-bis(2-morpholin-4-ylethyl)guanidine (PubChem CID 70081885) has the molecular formula C31H41FN8O3 and a molecular weight of 592.72 g/mol. Its IUPAC name is 1-carbamimidoyl-3-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1,2-bis(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-carbamimidoyl-3-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1,2-bis(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 70081885 |
| Molecular Formula | C31H41FN8O3 |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 1-carbamimidoyl-3-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-1,2-bis(2-morpholin-4-ylethyl)guanidine |
| SMILES | [H]/N=C(\N)N(CCN1CCOCC1)/C(=N\CCN1CCOCC1)Nc1cc(C(C)c2ccc(-c3ccccc3)c(F)c2)no1 |
| InChI | InChI=1S/C31H41FN8O3/c1-23(25-7-8-26(27(32)21-25)24-5-3-2-4-6-24)28-22-29(43-37-28)36-31(35-9-10-38-13-17-41-18-14-38)40(30(33)34)12-11-39-15-19-42-20-16-39/h2-8,21-23H,9-20H2,1H3,(H3,33,34)(H,35,36) |
| InChIKey | CBNYLLYZYIBKPI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|