C20H19FN4O3 — CID 18693459
2-[[amino-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]amino]methylidene]amino]acetic acid (PubChem CID 18693459) has the molecular formula C20H19FN4O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-[[amino-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]amino]methylidene]amino]acetic acid.
| Compound Name | 2-[[amino-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]amino]methylidene]amino]acetic acid |
|---|---|
| PubChem CID | 18693459 |
| Molecular Formula | C20H19FN4O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[[amino-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]amino]methylidene]amino]acetic acid |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(N/C(N)=N/CC(=O)O)on1 |
| InChI | InChI=1S/C20H19FN4O3/c1-12(17-10-18(28-25-17)24-20(22)23-11-19(26)27)14-7-8-15(16(21)9-14)13-5-3-2-4-6-13/h2-10,12H,11H2,1H3,(H,26,27)(H3,22,23,24) |
| InChIKey | OGUXDLIDZGYRQH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|