C23H25FN4O2 — CID 54302665
N'-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]morpholine-4-carboximidamide (PubChem CID 54302665) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is N'-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]morpholine-4-carboximidamide.
| Compound Name | N'-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 54302665 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N'-[[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]methyl]morpholine-4-carboximidamide |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(C/N=C(\N)N2CCOCC2)on1 |
| InChI | InChI=1S/C23H25FN4O2/c1-16(18-7-8-20(21(24)13-18)17-5-3-2-4-6-17)22-14-19(30-27-22)15-26-23(25)28-9-11-29-12-10-28/h2-8,13-14,16H,9-12,15H2,1H3,(H2,25,26) |
| InChIKey | SFILWBSSWUZORY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|