C23H25FN4O — CID 18693850
N'-[[5-[(3-fluoro-4-phenylphenyl)methyl]-1,2-oxazol-3-yl]methyl]piperidine-1-carboximidamide (PubChem CID 18693850) has the molecular formula C23H25FN4O and a molecular weight of 392.48 g/mol. Its IUPAC name is N'-[[5-[(3-fluoro-4-phenylphenyl)methyl]-1,2-oxazol-3-yl]methyl]piperidine-1-carboximidamide.
| Compound Name | N'-[[5-[(3-fluoro-4-phenylphenyl)methyl]-1,2-oxazol-3-yl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 18693850 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N'-[[5-[(3-fluoro-4-phenylphenyl)methyl]-1,2-oxazol-3-yl]methyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1cc(Cc2ccc(-c3ccccc3)c(F)c2)on1)N1CCCCC1 |
| InChI | InChI=1S/C23H25FN4O/c24-22-14-17(9-10-21(22)18-7-3-1-4-8-18)13-20-15-19(27-29-20)16-26-23(25)28-11-5-2-6-12-28/h1,3-4,7-10,14-15H,2,5-6,11-13,16H2,(H2,25,26) |
| InChIKey | INQIIIITZBKKGJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|