C22H23FN4O2S — CID 70081884
N'-[[5-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]methyl]-1,3,4-oxathiazinane-4-carboximidamide (PubChem CID 70081884) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is N'-[[5-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]methyl]-1,3,4-oxathiazinane-4-carboximidamide.
| Compound Name | N'-[[5-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]methyl]-1,3,4-oxathiazinane-4-carboximidamide |
|---|---|
| PubChem CID | 70081884 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N'-[[5-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]methyl]-1,3,4-oxathiazinane-4-carboximidamide |
| SMILES | N/C(=N\Cc1cc(CCc2ccc(-c3ccccc3)c(F)c2)on1)N1CCOCS1 |
| InChI | InChI=1S/C22H23FN4O2S/c23-21-12-16(7-9-20(21)17-4-2-1-3-5-17)6-8-19-13-18(26-29-19)14-25-22(24)27-10-11-28-15-30-27/h1-5,7,9,12-13H,6,8,10-11,14-15H2,(H2,24,25) |
| InChIKey | BPPVBNVADGLPOI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|