C25H27FN4O2 — CID 70083383
N'-[[3-[3-(3-fluoro-4-phenylphenyl)-2-methylprop-1-enyl]-1,2-oxazol-5-yl]methyl]morpholine-4-carboximidamide (PubChem CID 70083383) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is N'-[[3-[3-(3-fluoro-4-phenylphenyl)-2-methylprop-1-enyl]-1,2-oxazol-5-yl]methyl]morpholine-4-carboximidamide.
| Compound Name | N'-[[3-[3-(3-fluoro-4-phenylphenyl)-2-methylprop-1-enyl]-1,2-oxazol-5-yl]methyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 70083383 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N'-[[3-[3-(3-fluoro-4-phenylphenyl)-2-methylprop-1-enyl]-1,2-oxazol-5-yl]methyl]morpholine-4-carboximidamide |
| SMILES | CC(=Cc1cc(C/N=C(\N)N2CCOCC2)on1)Cc1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C25H27FN4O2/c1-18(13-19-7-8-23(24(26)15-19)20-5-3-2-4-6-20)14-21-16-22(32-29-21)17-28-25(27)30-9-11-31-12-10-30/h2-8,14-16H,9-13,17H2,1H3,(H2,27,28) |
| InChIKey | JCONALFVEBLKKP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|