C25H30FN5O2 — CID 118279948
1-[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-2-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 118279948) has the molecular formula C25H30FN5O2 and a molecular weight of 451.55 g/mol. Its IUPAC name is 1-[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-2-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-2-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 118279948 |
| Molecular Formula | C25H30FN5O2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 1-[3-[2-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-2-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | N/C(=N\CCCN1CCOCC1)Nc1cc(CCc2ccc(-c3ccccc3)c(F)c2)no1 |
| InChI | InChI=1S/C25H30FN5O2/c26-23-17-19(8-10-22(23)20-5-2-1-3-6-20)7-9-21-18-24(33-30-21)29-25(27)28-11-4-12-31-13-15-32-16-14-31/h1-3,5-6,8,10,17-18H,4,7,9,11-16H2,(H3,27,28,29) |
| InChIKey | ZJTUOTUMKCYHQA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|