C24H28FN5O2 — CID 18693469
1-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-2-(2-morpholin-4-ylethyl)guanidine (PubChem CID 18693469) has the molecular formula C24H28FN5O2 and a molecular weight of 437.52 g/mol. Its IUPAC name is 1-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-2-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-2-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 18693469 |
| Molecular Formula | C24H28FN5O2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[3-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]-2-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1cc(N/C(N)=N/CCN2CCOCC2)on1 |
| InChI | InChI=1S/C24H28FN5O2/c1-17(19-7-8-20(21(25)15-19)18-5-3-2-4-6-18)22-16-23(32-29-22)28-24(26)27-9-10-30-11-13-31-14-12-30/h2-8,15-17H,9-14H2,1H3,(H3,26,27,28) |
| InChIKey | HQTBJQNGJBDKQJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|