C22H24N4O2 — CID 54149386
N'-[3-[1-(4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide (PubChem CID 54149386) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N'-[3-[1-(4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide.
| Compound Name | N'-[3-[1-(4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 54149386 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N'-[3-[1-(4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide |
| SMILES | CC(c1ccc(-c2ccccc2)cc1)c1cc(N=C(N)N2CCOCC2)on1 |
| InChI | InChI=1S/C22H24N4O2/c1-16(17-7-9-19(10-8-17)18-5-3-2-4-6-18)20-15-21(28-25-20)24-22(23)26-11-13-27-14-12-26/h2-10,15-16H,11-14H2,1H3,(H2,23,24) |
| InChIKey | OGRJGMJLQQVWHX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|