C23H25FN4O4 — CID 54542034
N'-[3-[(3-fluoro-4-phenylphenyl)-dimethoxymethyl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide (PubChem CID 54542034) has the molecular formula C23H25FN4O4 and a molecular weight of 440.48 g/mol. Its IUPAC name is N'-[3-[(3-fluoro-4-phenylphenyl)-dimethoxymethyl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide.
| Compound Name | N'-[3-[(3-fluoro-4-phenylphenyl)-dimethoxymethyl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 54542034 |
| Molecular Formula | C23H25FN4O4 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | N'-[3-[(3-fluoro-4-phenylphenyl)-dimethoxymethyl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide |
| SMILES | COC(OC)(c1ccc(-c2ccccc2)c(F)c1)c1cc(N=C(N)N2CCOCC2)on1 |
| InChI | InChI=1S/C23H25FN4O4/c1-29-23(30-2,17-8-9-18(19(24)14-17)16-6-4-3-5-7-16)20-15-21(32-27-20)26-22(25)28-10-12-31-13-11-28/h3-9,14-15H,10-13H2,1-2H3,(H2,25,26) |
| InChIKey | ZDWUYJGSIACEHI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|