C24H29FN4O5S — CID 86755585
N'-[3-[2-(3-fluoro-4-phenylphenyl)propan-2-yl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide;methanesulfonic acid (PubChem CID 86755585) has the molecular formula C24H29FN4O5S and a molecular weight of 504.58 g/mol. Its IUPAC name is N'-[3-[2-(3-fluoro-4-phenylphenyl)propan-2-yl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide;methanesulfonic acid.
| Compound Name | N'-[3-[2-(3-fluoro-4-phenylphenyl)propan-2-yl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide;methanesulfonic acid |
|---|---|
| PubChem CID | 86755585 |
| Molecular Formula | C24H29FN4O5S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N'-[3-[2-(3-fluoro-4-phenylphenyl)propan-2-yl]-1,2-oxazol-5-yl]morpholine-4-carboximidamide;methanesulfonic acid |
| SMILES | CC(C)(c1ccc(-c2ccccc2)c(F)c1)c1cc(N=C(N)N2CCOCC2)on1.CS(=O)(=O)O |
| InChI | InChI=1S/C23H25FN4O2.CH4O3S/c1-23(2,17-8-9-18(19(24)14-17)16-6-4-3-5-7-16)20-15-21(30-27-20)26-22(25)28-10-12-29-13-11-28;1-5(2,3)4/h3-9,14-15H,10-13H2,1-2H3,(H2,25,26);1H3,(H,2,3,4) |
| InChIKey | SWQOTVNFUGSCKN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|