C25H29FN4O6S — CID 173201833
[[[[3-[1-ethoxy-1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]amino]-morpholin-4-ylmethylidene]amino]methanesulfonic acid (PubChem CID 173201833) has the molecular formula C25H29FN4O6S and a molecular weight of 532.59 g/mol. Its IUPAC name is [[[[3-[1-ethoxy-1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]amino]-morpholin-4-ylmethylidene]amino]methanesulfonic acid.
| Compound Name | [[[[3-[1-ethoxy-1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]amino]-morpholin-4-ylmethylidene]amino]methanesulfonic acid |
|---|---|
| PubChem CID | 173201833 |
| Molecular Formula | C25H29FN4O6S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [[[[3-[1-ethoxy-1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-5-yl]amino]-morpholin-4-ylmethylidene]amino]methanesulfonic acid |
| SMILES | CCOC(C)(c1ccc(-c2ccccc2)c(F)c1)c1cc(NC(=NCS(=O)(=O)O)N2CCOCC2)on1 |
| InChI | InChI=1S/C25H29FN4O6S/c1-3-35-25(2,19-9-10-20(21(26)15-19)18-7-5-4-6-8-18)22-16-23(36-29-22)28-24(27-17-37(31,32)33)30-11-13-34-14-12-30/h4-10,15-16H,3,11-14,17H2,1-2H3,(H,27,28)(H,31,32,33) |
| InChIKey | KIYYHBDEJIFKGH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|