C22H22N4O2S — CID 18693542
N'-[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]-1,3-thiazolidine-3-carboximidamide (PubChem CID 18693542) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N'-[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]-1,3-thiazolidine-3-carboximidamide.
| Compound Name | N'-[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]-1,3-thiazolidine-3-carboximidamide |
|---|---|
| PubChem CID | 18693542 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N'-[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]-1,3-thiazolidine-3-carboximidamide |
| SMILES | CC(c1cccc(C(=O)c2ccccc2)c1)c1cc(/N=C(\N)N2CCSC2)on1 |
| InChI | InChI=1S/C22H22N4O2S/c1-15(19-13-20(28-25-19)24-22(23)26-10-11-29-14-26)17-8-5-9-18(12-17)21(27)16-6-3-2-4-7-16/h2-9,12-13,15H,10-11,14H2,1H3,(H2,23,24) |
| InChIKey | BHQAHICBONTYGV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|