C25H26N4O3 — CID 18693520
N'-[3-[2-(3-benzoylphenyl)propan-2-yl]-1,2-oxazol-5-yl]-4-oxopiperidine-1-carboximidamide (PubChem CID 18693520) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is N'-[3-[2-(3-benzoylphenyl)propan-2-yl]-1,2-oxazol-5-yl]-4-oxopiperidine-1-carboximidamide.
| Compound Name | N'-[3-[2-(3-benzoylphenyl)propan-2-yl]-1,2-oxazol-5-yl]-4-oxopiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 18693520 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N'-[3-[2-(3-benzoylphenyl)propan-2-yl]-1,2-oxazol-5-yl]-4-oxopiperidine-1-carboximidamide |
| SMILES | CC(C)(c1cccc(C(=O)c2ccccc2)c1)c1cc(/N=C(\N)N2CCC(=O)CC2)on1 |
| InChI | InChI=1S/C25H26N4O3/c1-25(2,19-10-6-9-18(15-19)23(31)17-7-4-3-5-8-17)21-16-22(32-28-21)27-24(26)29-13-11-20(30)12-14-29/h3-10,15-16H,11-14H2,1-2H3,(H2,26,27) |
| InChIKey | MVRPZLAVZFDMLC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 101.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|