C24H26N4O2 — CID 70082813
N'-[3-[2-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]piperidine-1-carboximidamide (PubChem CID 70082813) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N'-[3-[2-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]piperidine-1-carboximidamide.
| Compound Name | N'-[3-[2-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 70082813 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N'-[3-[2-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]piperidine-1-carboximidamide |
| SMILES | NC(=Nc1cc(CCc2cccc(C(=O)c3ccccc3)c2)no1)N1CCCCC1 |
| InChI | InChI=1S/C24H26N4O2/c25-24(28-14-5-2-6-15-28)26-22-17-21(27-30-22)13-12-18-8-7-11-20(16-18)23(29)19-9-3-1-4-10-19/h1,3-4,7-11,16-17H,2,5-6,12-15H2,(H2,25,26) |
| InChIKey | RREHQLXSOSYZME-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|