C25H29ClN4O2S — CID 70107913
N'-[3-[1-(3-benzoylphenyl)ethyl]-1,2-thiazol-5-yl]-N,N-dimethylmorpholine-4-carboximidamide;hydrochloride (PubChem CID 70107913) has the molecular formula C25H29ClN4O2S and a molecular weight of 485.05 g/mol. Its IUPAC name is N'-[3-[1-(3-benzoylphenyl)ethyl]-1,2-thiazol-5-yl]-N,N-dimethylmorpholine-4-carboximidamide;hydrochloride.
| Compound Name | N'-[3-[1-(3-benzoylphenyl)ethyl]-1,2-thiazol-5-yl]-N,N-dimethylmorpholine-4-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 70107913 |
| Molecular Formula | C25H29ClN4O2S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N'-[3-[1-(3-benzoylphenyl)ethyl]-1,2-thiazol-5-yl]-N,N-dimethylmorpholine-4-carboximidamide;hydrochloride |
| SMILES | CC(c1cccc(C(=O)c2ccccc2)c1)c1cc(N=C(N(C)C)N2CCOCC2)sn1.Cl |
| InChI | InChI=1S/C25H28N4O2S.ClH/c1-18(20-10-7-11-21(16-20)24(30)19-8-5-4-6-9-19)22-17-23(32-27-22)26-25(28(2)3)29-12-14-31-15-13-29;/h4-11,16-18H,12-15H2,1-3H3;1H |
| InChIKey | FCKQSFJGTVIODC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|