C26H30N6O4 — CID 70107115
2-[[N-[5-[1-(3-benzoylphenyl)ethyl]-2-methyl-1,2,4-triazol-3-yl]-C-morpholin-4-ylcarbonimidoyl]-methylamino]acetic acid (PubChem CID 70107115) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[[N-[5-[1-(3-benzoylphenyl)ethyl]-2-methyl-1,2,4-triazol-3-yl]-C-morpholin-4-ylcarbonimidoyl]-methylamino]acetic acid.
| Compound Name | 2-[[N-[5-[1-(3-benzoylphenyl)ethyl]-2-methyl-1,2,4-triazol-3-yl]-C-morpholin-4-ylcarbonimidoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 70107115 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 2-[[N-[5-[1-(3-benzoylphenyl)ethyl]-2-methyl-1,2,4-triazol-3-yl]-C-morpholin-4-ylcarbonimidoyl]-methylamino]acetic acid |
| SMILES | CC(c1cccc(C(=O)c2ccccc2)c1)c1nc(N=C(N(C)CC(=O)O)N2CCOCC2)n(C)n1 |
| InChI | InChI=1S/C26H30N6O4/c1-18(20-10-7-11-21(16-20)23(35)19-8-5-4-6-9-19)24-27-25(31(3)29-24)28-26(30(2)17-22(33)34)32-12-14-36-15-13-32/h4-11,16,18H,12-15,17H2,1-3H3,(H,33,34) |
| InChIKey | XQYARFXAUWUUAJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|