C21H20N4O4 — CID 18693618
2-[[amino-[[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]amino]methylidene]amino]acetic acid (PubChem CID 18693618) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-[[amino-[[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]amino]methylidene]amino]acetic acid.
| Compound Name | 2-[[amino-[[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]amino]methylidene]amino]acetic acid |
|---|---|
| PubChem CID | 18693618 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[[amino-[[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]amino]methylidene]amino]acetic acid |
| SMILES | CC(c1cccc(C(=O)c2ccccc2)c1)c1cc(N/C(N)=N/CC(=O)O)on1 |
| InChI | InChI=1S/C21H20N4O4/c1-13(17-11-18(29-25-17)24-21(22)23-12-19(26)27)15-8-5-9-16(10-15)20(28)14-6-3-2-4-7-14/h2-11,13H,12H2,1H3,(H,26,27)(H3,22,23,24) |
| InChIKey | AYJHCLSSCXGCDN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 130.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|