C24H28N4O4 — CID 18693971
1-[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]-2-[2-(3-hydroxypropoxy)ethyl]guanidine (PubChem CID 18693971) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]-2-[2-(3-hydroxypropoxy)ethyl]guanidine.
| Compound Name | 1-[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]-2-[2-(3-hydroxypropoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 18693971 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 1-[3-[1-(3-benzoylphenyl)ethyl]-1,2-oxazol-5-yl]-2-[2-(3-hydroxypropoxy)ethyl]guanidine |
| SMILES | CC(c1cccc(C(=O)c2ccccc2)c1)c1cc(N/C(N)=N/CCOCCCO)on1 |
| InChI | InChI=1S/C24H28N4O4/c1-17(19-9-5-10-20(15-19)23(30)18-7-3-2-4-8-18)21-16-22(32-28-21)27-24(25)26-11-14-31-13-6-12-29/h2-5,7-10,15-17,29H,6,11-14H2,1H3,(H3,25,26,27) |
| InChIKey | HEVXOFJYPBEYRH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|