C19H25N2O4+ — CID 143520637
aminoazanium;3-hydroxypropyl 2-(3-benzoylphenyl)propanoate (PubChem CID 143520637) has the molecular formula C19H25N2O4+ and a molecular weight of 345.42 g/mol. Its IUPAC name is aminoazanium;3-hydroxypropyl 2-(3-benzoylphenyl)propanoate.
| Compound Name | aminoazanium;3-hydroxypropyl 2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 143520637 |
| Molecular Formula | C19H25N2O4+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | aminoazanium;3-hydroxypropyl 2-(3-benzoylphenyl)propanoate |
| SMILES | CC(C(=O)OCCCO)c1cccc(C(=O)c2ccccc2)c1.N[NH3+] |
| InChI | InChI=1S/C19H20O4.H4N2/c1-14(19(22)23-12-6-11-20)16-9-5-10-17(13-16)18(21)15-7-3-2-4-8-15;1-2/h2-5,7-10,13-14,20H,6,11-12H2,1H3;1-2H2/p+1 |
| InChIKey | QXNFCFXREMRNGP-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|