C19H20ClNO3 — CID 146615708
3-(chloroamino)propyl (2R)-2-(3-benzoylphenyl)propanoate (PubChem CID 146615708) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is 3-(chloroamino)propyl (2R)-2-(3-benzoylphenyl)propanoate.
| Compound Name | 3-(chloroamino)propyl (2R)-2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 146615708 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-(chloroamino)propyl (2R)-2-(3-benzoylphenyl)propanoate |
| SMILES | C[C@@H](C(=O)OCCCNCl)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H20ClNO3/c1-14(19(23)24-12-6-11-21-20)16-9-5-10-17(13-16)18(22)15-7-3-2-4-8-15/h2-5,7-10,13-14,21H,6,11-12H2,1H3/t14-/m1/s1 |
| InChIKey | ZVUQZBFXZGPNAZ-CQSZACIVSA-N |
| XLogP | 3.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|