C42H42O12 — CID 124834995
2-[2-[2-[2-[2-[(2R)-2-(3-benzoylphenyl)propanoyl]oxyethoxy]acetyl]oxyethoxy]-2-oxoethoxy]ethyl (2S)-2-(3-benzoylphenyl)propanoate (PubChem CID 124834995) has the molecular formula C42H42O12 and a molecular weight of 738.79 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[(2R)-2-(3-benzoylphenyl)propanoyl]oxyethoxy]acetyl]oxyethoxy]-2-oxoethoxy]ethyl (2S)-2-(3-benzoylphenyl)propanoate.
| Compound Name | 2-[2-[2-[2-[2-[(2R)-2-(3-benzoylphenyl)propanoyl]oxyethoxy]acetyl]oxyethoxy]-2-oxoethoxy]ethyl (2S)-2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 124834995 |
| Molecular Formula | C42H42O12 |
| Molecular Weight | 738.79 g/mol |
| Exact Mass | 738.27 |
| IUPAC Name | 2-[2-[2-[2-[2-[(2R)-2-(3-benzoylphenyl)propanoyl]oxyethoxy]acetyl]oxyethoxy]-2-oxoethoxy]ethyl (2S)-2-(3-benzoylphenyl)propanoate |
| SMILES | C[C@H](C(=O)OCCOCC(=O)OCCOC(=O)COCCOC(=O)[C@H](C)c1cccc(C(=O)c2ccccc2)c1)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C42H42O12/c1-29(33-15-9-17-35(25-33)39(45)31-11-5-3-6-12-31)41(47)53-21-19-49-27-37(43)51-23-24-52-38(44)28-50-20-22-54-42(48)30(2)34-16-10-18-36(26-34)40(46)32-13-7-4-8-14-32/h3-18,25-26,29-30H,19-24,27-28H2,1-2H3/t29-,30+ |
| InChIKey | FCSXTKFMHMDZEC-RNPORBBMSA-N |
| XLogP | 5.26 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.79 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|