C22H24O5 — CID 124835090
6-[(2R)-2-(3-benzoylphenyl)propanoyl]oxyhexanoic acid (PubChem CID 124835090) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 6-[(2R)-2-(3-benzoylphenyl)propanoyl]oxyhexanoic acid.
| Compound Name | 6-[(2R)-2-(3-benzoylphenyl)propanoyl]oxyhexanoic acid |
|---|---|
| PubChem CID | 124835090 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 6-[(2R)-2-(3-benzoylphenyl)propanoyl]oxyhexanoic acid |
| SMILES | C[C@@H](C(=O)OCCCCCC(=O)O)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H24O5/c1-16(22(26)27-14-7-3-6-13-20(23)24)18-11-8-12-19(15-18)21(25)17-9-4-2-5-10-17/h2,4-5,8-12,15-16H,3,6-7,13-14H2,1H3,(H,23,24)/t16-/m1/s1 |
| InChIKey | HPRWHZFBQXKVLY-MRXNPFEDSA-N |
| XLogP | 4.21 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|