C22H24O9S — CID 124835675
2-[2-[2-[2-[(2S)-2-(5-benzoylthiophen-2-yl)propanoyl]oxyethoxy]acetyl]oxyethoxy]acetic acid (PubChem CID 124835675) has the molecular formula C22H24O9S and a molecular weight of 464.49 g/mol. Its IUPAC name is 2-[2-[2-[2-[(2S)-2-(5-benzoylthiophen-2-yl)propanoyl]oxyethoxy]acetyl]oxyethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[(2S)-2-(5-benzoylthiophen-2-yl)propanoyl]oxyethoxy]acetyl]oxyethoxy]acetic acid |
|---|---|
| PubChem CID | 124835675 |
| Molecular Formula | C22H24O9S |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-[2-[2-[2-[(2S)-2-(5-benzoylthiophen-2-yl)propanoyl]oxyethoxy]acetyl]oxyethoxy]acetic acid |
| SMILES | C[C@@H](C(=O)OCCOCC(=O)OCCOCC(=O)O)c1ccc(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C22H24O9S/c1-15(17-7-8-18(32-17)21(26)16-5-3-2-4-6-16)22(27)31-12-10-29-14-20(25)30-11-9-28-13-19(23)24/h2-8,15H,9-14H2,1H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | DVUTYOJNBAHLCB-OAHLLOKOSA-N |
| XLogP | 2.29 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|