C34H30O10S2 — CID 124914059
(2R)-2-(5-benzoylthiophen-2-yl)-4-[2-[2-[(2S)-2-(5-benzoylthiophen-2-yl)propanoyl]oxyacetyl]oxyethoxy]-2-methyl-4-oxobutanoic acid (PubChem CID 124914059) has the molecular formula C34H30O10S2 and a molecular weight of 662.74 g/mol. Its IUPAC name is (2R)-2-(5-benzoylthiophen-2-yl)-4-[2-[2-[(2S)-2-(5-benzoylthiophen-2-yl)propanoyl]oxyacetyl]oxyethoxy]-2-methyl-4-oxobutanoic acid.
| Compound Name | (2R)-2-(5-benzoylthiophen-2-yl)-4-[2-[2-[(2S)-2-(5-benzoylthiophen-2-yl)propanoyl]oxyacetyl]oxyethoxy]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 124914059 |
| Molecular Formula | C34H30O10S2 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.13 |
| IUPAC Name | (2R)-2-(5-benzoylthiophen-2-yl)-4-[2-[2-[(2S)-2-(5-benzoylthiophen-2-yl)propanoyl]oxyacetyl]oxyethoxy]-2-methyl-4-oxobutanoic acid |
| SMILES | C[C@@H](C(=O)OCC(=O)OCCOC(=O)C[C@](C)(C(=O)O)c1ccc(C(=O)c2ccccc2)s1)c1ccc(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C34H30O10S2/c1-21(24-13-14-25(45-24)30(37)22-9-5-3-6-10-22)32(39)44-20-29(36)43-18-17-42-28(35)19-34(2,33(40)41)27-16-15-26(46-27)31(38)23-11-7-4-8-12-23/h3-16,21H,17-20H2,1-2H3,(H,40,41)/t21-,34+/m1/s1 |
| InChIKey | VZZUAVGPVXDKQG-IFXFPORBSA-N |
| XLogP | 5.44 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|