C19H23NO3 — CID 174596221
2-amino-2,3-dimethylbutanoic acid;diphenylmethanone (PubChem CID 174596221) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-amino-2,3-dimethylbutanoic acid;diphenylmethanone.
| Compound Name | 2-amino-2,3-dimethylbutanoic acid;diphenylmethanone |
|---|---|
| PubChem CID | 174596221 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-amino-2,3-dimethylbutanoic acid;diphenylmethanone |
| SMILES | CC(C)C(C)(N)C(=O)O.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C6H13NO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-4(2)6(3,7)5(8)9/h1-10H;4H,7H2,1-3H3,(H,8,9) |
| InChIKey | DJGKRYFJFJLOTN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |