About (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide
(5-benzoylthiophen-2-yl)-phenylmethanone;boranuide (PubChem CID 158491316) has the molecular formula C18H16BO2S-
and a molecular weight of 307.20 g/mol. Its IUPAC name is (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide.
Molecular Properties
| Compound Name | (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide |
| PubChem CID | 158491316 |
| Molecular Formula | C18H16BO2S- |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide |
| SMILES | O=C(c1ccccc1)c1ccc(C(=O)c2ccccc2)s1.[BH4-] |
| InChI | InChI=1S/C18H12O2S.BH4/c19-17(13-7-3-1-4-8-13)15-11-12-16(21-15)18(20)14-9-5-2-6-10-14;/h1-12H;1H4/q;-1 |
| InChIKey | HISPSCUSFQHAIP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide?
The IUPAC name of (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide (CID 158491316) is (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide.
What is the SMILES notation for (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide?
The canonical SMILES for (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide is O=C(c1ccccc1)c1ccc(C(=O)c2ccccc2)s1.[BH4-].
What is the InChIKey of (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide?
The InChIKey is HISPSCUSFQHAIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O2S.BH4/c19-17(13-7-3-1-4-8-13)15-11-12-16(21-15)18(20)14-9-5-2-6-10-14;/h1-12H;1H4/q;-1.
What are the key properties of (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide?
(5-benzoylthiophen-2-yl)-phenylmethanone;boranuide has a molecular weight of 307.20 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-benzoylthiophen-2-yl)-phenylmethanone;boranuide is sourced from PubChem (CID 158491316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).