C25H30N2O6 — CID 155458267
2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethyl 2-(3-benzoylphenyl)propanoate (PubChem CID 155458267) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethyl 2-(3-benzoylphenyl)propanoate.
| Compound Name | 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethyl 2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 155458267 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]ethyl 2-(3-benzoylphenyl)propanoate |
| SMILES | CC(C(=O)OCCNC(=O)CNC(=O)OC(C)(C)C)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H30N2O6/c1-17(19-11-8-12-20(15-19)22(29)18-9-6-5-7-10-18)23(30)32-14-13-26-21(28)16-27-24(31)33-25(2,3)4/h5-12,15,17H,13-14,16H2,1-4H3,(H,26,28)(H,27,31) |
| InChIKey | OWYPOWHKGBPXMS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|