C44H52O16 — CID 169442762
[(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] 2-(3-benzoylphenyl)propanoate;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-(3-benzoylphenyl)propanoate (PubChem CID 169442762) has the molecular formula C44H52O16 and a molecular weight of 836.88 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] 2-(3-benzoylphenyl)propanoate;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-(3-benzoylphenyl)propanoate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] 2-(3-benzoylphenyl)propanoate;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-(3-benzoylphenyl)propanoate |
|---|---|
| PubChem CID | 169442762 |
| Molecular Formula | C44H52O16 |
| Molecular Weight | 836.88 g/mol |
| Exact Mass | 836.33 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexyl] 2-(3-benzoylphenyl)propanoate;[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 2-(3-benzoylphenyl)propanoate |
| SMILES | CC(C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO)c1cccc(C(=O)c2ccccc2)c1.CC(C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/2C22H26O8/c2*1-13(22(29)30-12-18(25)21(28)20(27)17(24)11-23)15-8-5-9-16(10-15)19(26)14-6-3-2-4-7-14/h2*2-10,13,17-18,20-21,23-25,27-28H,11-12H2,1H3/t13?,17-,18+,20+,21+;13?,17-,18-,20-,21-/m01/s1 |
| InChIKey | NUEBBPMXERWLTG-LYZAYGBWSA-N |
| XLogP | 0.00 |
| TPSA | 289.04 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.88 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |