C19H19FN4O — CID 18693704
1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]-2-methylguanidine (PubChem CID 18693704) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is 1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]-2-methylguanidine.
| Compound Name | 1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 18693704 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-3-yl]-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1cc(C(C)c2ccc(-c3ccccc3)c(F)c2)on1 |
| InChI | InChI=1S/C19H19FN4O/c1-12(17-11-18(24-25-17)23-19(21)22-2)14-8-9-15(16(20)10-14)13-6-4-3-5-7-13/h3-12H,1-2H3,(H3,21,22,23,24) |
| InChIKey | PCIWLNVPMJKTJP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|