C23H25FN4O3 — CID 18693909
2-[3-[[[amino(dimethylamino)methylidene]amino]methyl]-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-4-yl]acetic acid (PubChem CID 18693909) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 2-[3-[[[amino(dimethylamino)methylidene]amino]methyl]-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-4-yl]acetic acid.
| Compound Name | 2-[3-[[[amino(dimethylamino)methylidene]amino]methyl]-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 18693909 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[3-[[[amino(dimethylamino)methylidene]amino]methyl]-5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,2-oxazol-4-yl]acetic acid |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1onc(C/N=C(\N)N(C)C)c1CC(=O)O |
| InChI | InChI=1S/C23H25FN4O3/c1-14(16-9-10-17(19(24)11-16)15-7-5-4-6-8-15)22-18(12-21(29)30)20(27-31-22)13-26-23(25)28(2)3/h4-11,14H,12-13H2,1-3H3,(H2,25,26)(H,29,30) |
| InChIKey | GIJYKTUQLLPBHR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|