C20H22FN5S — CID 142039316
1-ethyl-3-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-thiadiazol-2-yl]-2-methylguanidine (PubChem CID 142039316) has the molecular formula C20H22FN5S and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-ethyl-3-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-thiadiazol-2-yl]-2-methylguanidine.
| Compound Name | 1-ethyl-3-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-thiadiazol-2-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 142039316 |
| Molecular Formula | C20H22FN5S |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 1-ethyl-3-[5-[1-(3-fluoro-4-phenylphenyl)ethyl]-1,3,4-thiadiazol-2-yl]-2-methylguanidine |
| SMILES | CCN/C(=N\C)Nc1nnc(C(C)c2ccc(-c3ccccc3)c(F)c2)s1 |
| InChI | InChI=1S/C20H22FN5S/c1-4-23-19(22-3)24-20-26-25-18(27-20)13(2)15-10-11-16(17(21)12-15)14-8-6-5-7-9-14/h5-13H,4H2,1-3H3,(H2,22,23,24,26) |
| InChIKey | ULOPZUKSXIAAPR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|