About (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide
(2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide (PubChem CID 985824) has the molecular formula C21H16F3NO
and a molecular weight of 355.36 g/mol. Its IUPAC name is (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide.
Molecular Properties
| Compound Name | (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide |
| PubChem CID | 985824 |
| Molecular Formula | C21H16F3NO |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cc(F)cc(F)c1)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C21H16F3NO/c1-13(21(26)25-18-11-16(22)10-17(23)12-18)15-7-8-19(20(24)9-15)14-5-3-2-4-6-14/h2-13H,1H3,(H,25,26)/t13-/m0/s1 |
| InChIKey | LBUMKHQTDMIDBX-ZDUSSCGKSA-N |
| XLogP | 5.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide?
The IUPAC name of (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide (CID 985824) is (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide.
What is the SMILES notation for (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide?
The canonical SMILES for (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide is C[C@H](C(=O)Nc1cc(F)cc(F)c1)c1ccc(-c2ccccc2)c(F)c1.
What is the InChIKey of (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide?
The InChIKey is LBUMKHQTDMIDBX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C21H16F3NO/c1-13(21(26)25-18-11-16(22)10-17(23)12-18)15-7-8-19(20(24)9-15)14-5-3-2-4-6-14/h2-13H,1H3,(H,25,26)/t13-/m0/s1.
What are the key properties of (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide?
(2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide has a molecular weight of 355.36 g/mol, XLogP of 5.51, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(3,5-difluorophenyl)-2-(3-fluoro-4-phenylphenyl)propanamide is sourced from PubChem (CID 985824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).