C22H20FNO — CID 850709
(2R)-2-(3-fluoro-4-phenylphenyl)-N-(2-methylphenyl)propanamide (PubChem CID 850709) has the molecular formula C22H20FNO and a molecular weight of 333.41 g/mol. Its IUPAC name is (2R)-2-(3-fluoro-4-phenylphenyl)-N-(2-methylphenyl)propanamide.
| Compound Name | (2R)-2-(3-fluoro-4-phenylphenyl)-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 850709 |
| Molecular Formula | C22H20FNO |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (2R)-2-(3-fluoro-4-phenylphenyl)-N-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1NC(=O)[C@H](C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C22H20FNO/c1-15-8-6-7-11-21(15)24-22(25)16(2)18-12-13-19(20(23)14-18)17-9-4-3-5-10-17/h3-14,16H,1-2H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | JAZJXHCJXAKHIZ-MRXNPFEDSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |